C23H18BrN5S — CID 6547714
(8R,8aR)-6-amino-2-benzyl-8-(4-bromothiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 6547714) has the molecular formula C23H18BrN5S and a molecular weight of 476.40 g/mol. Its IUPAC name is (8R,8aR)-6-amino-2-benzyl-8-(4-bromothiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-6-amino-2-benzyl-8-(4-bromothiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 6547714 |
| Molecular Formula | C23H18BrN5S |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | (8R,8aR)-6-amino-2-benzyl-8-(4-bromothiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@H](c2cc(Br)cs2)[C@H]2CN(Cc3ccccc3)CC=C12 |
| InChI | InChI=1S/C23H18BrN5S/c24-16-8-20(30-12-16)21-19-11-29(10-15-4-2-1-3-5-15)7-6-17(19)18(9-25)22(28)23(21,13-26)14-27/h1-6,8,12,19,21H,7,10-11,28H2/t19-,21-/m0/s1 |
| InChIKey | BKZLMJDCBGJVIH-FPOVZHCZSA-N |
| XLogP | 4.44 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|