C17H15N5S — CID 5284728
(8R,8aR)-6-amino-2-methyl-8-thiophen-2-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 5284728) has the molecular formula C17H15N5S and a molecular weight of 321.41 g/mol. Its IUPAC name is (8R,8aR)-6-amino-2-methyl-8-thiophen-2-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-6-amino-2-methyl-8-thiophen-2-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 5284728 |
| Molecular Formula | C17H15N5S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (8R,8aR)-6-amino-2-methyl-8-thiophen-2-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3cccs3)[C@H]2C1 |
| InChI | InChI=1S/C17H15N5S/c1-22-5-4-11-12(7-18)16(21)17(9-19,10-20)15(13(11)8-22)14-3-2-6-23-14/h2-4,6,13,15H,5,8,21H2,1H3/t13-,15-/m0/s1 |
| InChIKey | WOHNISVLVOSZRX-ZFWWWQNUSA-N |
| XLogP | 2.10 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|