C19H17N5S — CID 657926
(3S)-5-amino-12-methyl-3-thiophen-2-yl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile (PubChem CID 657926) has the molecular formula C19H17N5S and a molecular weight of 347.45 g/mol. Its IUPAC name is (3S)-5-amino-12-methyl-3-thiophen-2-yl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile.
| Compound Name | (3S)-5-amino-12-methyl-3-thiophen-2-yl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile |
|---|---|
| PubChem CID | 657926 |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (3S)-5-amino-12-methyl-3-thiophen-2-yl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile |
| SMILES | CN1C2C=C3C(C#N)=C(N)C(C#N)(C#N)[C@@H](c4cccs4)C3C1CC2 |
| InChI | InChI=1S/C19H17N5S/c1-24-11-4-5-14(24)16-12(7-11)13(8-20)18(23)19(9-21,10-22)17(16)15-3-2-6-25-15/h2-3,6-7,11,14,16-17H,4-5,23H2,1H3/t11?,14?,16?,17-/m0/s1 |
| InChIKey | VCWFGDAOTFYHFQ-MJTTZUFASA-N |
| XLogP | 2.63 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|