C19H19N5S — CID 912177
(8S,8aR)-6-amino-2-ethyl-8-(5-methylthiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 912177) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is (8S,8aR)-6-amino-2-ethyl-8-(5-methylthiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aR)-6-amino-2-ethyl-8-(5-methylthiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 912177 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (8S,8aR)-6-amino-2-ethyl-8-(5-methylthiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@@H](c3ccc(C)s3)[C@H]2C1 |
| InChI | InChI=1S/C19H19N5S/c1-3-24-7-6-13-14(8-20)18(23)19(10-21,11-22)17(15(13)9-24)16-5-4-12(2)25-16/h4-6,15,17H,3,7,9,23H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | FAUJHGKEZXHTEO-DOTOQJQBSA-N |
| XLogP | 2.80 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|