C22H21N5O2 — CID 1003386
methyl 4-[(8R,8aR)-6-amino-5,7,7-tricyano-2-ethyl-1,3,8,8a-tetrahydroisoquinolin-8-yl]benzoate (PubChem CID 1003386) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 4-[(8R,8aR)-6-amino-5,7,7-tricyano-2-ethyl-1,3,8,8a-tetrahydroisoquinolin-8-yl]benzoate.
| Compound Name | methyl 4-[(8R,8aR)-6-amino-5,7,7-tricyano-2-ethyl-1,3,8,8a-tetrahydroisoquinolin-8-yl]benzoate |
|---|---|
| PubChem CID | 1003386 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | methyl 4-[(8R,8aR)-6-amino-5,7,7-tricyano-2-ethyl-1,3,8,8a-tetrahydroisoquinolin-8-yl]benzoate |
| SMILES | CCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@@H](c3ccc(C(=O)OC)cc3)[C@H]2C1 |
| InChI | InChI=1S/C22H21N5O2/c1-3-27-9-8-16-17(10-23)20(26)22(12-24,13-25)19(18(16)11-27)14-4-6-15(7-5-14)21(28)29-2/h4-8,18-19H,3,9,11,26H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | OIRJQSQBJHUUCV-OALUTQOASA-N |
| XLogP | 2.22 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|