C26H35N5O3 — CID 90486046
(8R,8aS)-6-amino-8-(4-ethoxyphenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile;ethanol (PubChem CID 90486046) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is (8R,8aS)-6-amino-8-(4-ethoxyphenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile;ethanol.
| Compound Name | (8R,8aS)-6-amino-8-(4-ethoxyphenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile;ethanol |
|---|---|
| PubChem CID | 90486046 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (8R,8aS)-6-amino-8-(4-ethoxyphenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile;ethanol |
| SMILES | CCO.CCO.CCOc1ccc([C@H]2[C@@H]3CN(CC)CC=C3C(C#N)=C(N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C22H23N5O.2C2H6O/c1-3-27-10-9-17-18(11-23)21(26)22(13-24,14-25)20(19(17)12-27)15-5-7-16(8-6-15)28-4-2;2*1-2-3/h5-9,19-20H,3-4,10,12,26H2,1-2H3;2*3H,2H2,1H3/t19-,20+;;/m1../s1 |
| InChIKey | UQWHHFRQERZXMV-AAYDIPMQSA-N |
| XLogP | 2.83 |
| TPSA | 150.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|