C21H21N5 — CID 4663234
6-amino-2-ethyl-8-(3-methylphenyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 4663234) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6-amino-2-ethyl-8-(3-methylphenyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | 6-amino-2-ethyl-8-(3-methylphenyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 4663234 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 6-amino-2-ethyl-8-(3-methylphenyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)C(c3cccc(C)c3)C2C1 |
| InChI | InChI=1S/C21H21N5/c1-3-26-8-7-16-17(10-22)20(25)21(12-23,13-24)19(18(16)11-26)15-6-4-5-14(2)9-15/h4-7,9,18-19H,3,8,11,25H2,1-2H3 |
| InChIKey | RJSLZGNOQZNJLA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|