C26H22ClN5 — CID 3816366
6-amino-8-(4-chlorophenyl)-2-(2-phenylethyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 3816366) has the molecular formula C26H22ClN5 and a molecular weight of 439.95 g/mol. Its IUPAC name is 6-amino-8-(4-chlorophenyl)-2-(2-phenylethyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | 6-amino-8-(4-chlorophenyl)-2-(2-phenylethyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 3816366 |
| Molecular Formula | C26H22ClN5 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 6-amino-8-(4-chlorophenyl)-2-(2-phenylethyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2ccc(Cl)cc2)C2CN(CCc3ccccc3)CC=C12 |
| InChI | InChI=1S/C26H22ClN5/c27-20-8-6-19(7-9-20)24-23-15-32(12-10-18-4-2-1-3-5-18)13-11-21(23)22(14-28)25(31)26(24,16-29)17-30/h1-9,11,23-24H,10,12-13,15,31H2 |
| InChIKey | IAJICNSMEBWUPO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|