C24H20N6 — CID 6581631
(8R,8aS)-6-amino-2-benzyl-8-pyridin-3-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 6581631) has the molecular formula C24H20N6 and a molecular weight of 392.47 g/mol. Its IUPAC name is (8R,8aS)-6-amino-2-benzyl-8-pyridin-3-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-amino-2-benzyl-8-pyridin-3-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 6581631 |
| Molecular Formula | C24H20N6 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (8R,8aS)-6-amino-2-benzyl-8-pyridin-3-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2cccnc2)[C@@H]2CN(Cc3ccccc3)CC=C12 |
| InChI | InChI=1S/C24H20N6/c25-11-20-19-8-10-30(13-17-5-2-1-3-6-17)14-21(19)22(18-7-4-9-29-12-18)24(15-26,16-27)23(20)28/h1-9,12,21-22H,10,13-14,28H2/t21-,22+/m1/s1 |
| InChIKey | LTNWOHXEDMUQNL-YADHBBJMSA-N |
| XLogP | 3.01 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|