C29H23N5 — CID 51708340
(8R,8aS)-6-amino-2-benzyl-8-naphthalen-1-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 51708340) has the molecular formula C29H23N5 and a molecular weight of 441.54 g/mol. Its IUPAC name is (8R,8aS)-6-amino-2-benzyl-8-naphthalen-1-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-amino-2-benzyl-8-naphthalen-1-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 51708340 |
| Molecular Formula | C29H23N5 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (8R,8aS)-6-amino-2-benzyl-8-naphthalen-1-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2cccc3ccccc23)[C@@H]2CN(Cc3ccccc3)CC=C12 |
| InChI | InChI=1S/C29H23N5/c30-15-25-23-13-14-34(16-20-7-2-1-3-8-20)17-26(23)27(29(18-31,19-32)28(25)33)24-12-6-10-21-9-4-5-11-22(21)24/h1-13,26-27H,14,16-17,33H2/t26-,27+/m1/s1 |
| InChIKey | PPXULTQNGHRABN-SXOMAYOGSA-N |
| XLogP | 4.77 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|