C17H13N5O — CID 1089693
(8R,8aR)-6-amino-8-pyridin-3-yl-1,3,8,8a-tetrahydroisochromene-5,7,7-tricarbonitrile (PubChem CID 1089693) has the molecular formula C17H13N5O and a molecular weight of 303.32 g/mol. Its IUPAC name is (8R,8aR)-6-amino-8-pyridin-3-yl-1,3,8,8a-tetrahydroisochromene-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-6-amino-8-pyridin-3-yl-1,3,8,8a-tetrahydroisochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 1089693 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (8R,8aR)-6-amino-8-pyridin-3-yl-1,3,8,8a-tetrahydroisochromene-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2cccnc2)[C@H]2COCC=C12 |
| InChI | InChI=1S/C17H13N5O/c18-6-13-12-3-5-23-8-14(12)15(11-2-1-4-22-7-11)17(9-19,10-20)16(13)21/h1-4,7,14-15H,5,8,21H2/t14-,15-/m0/s1 |
| InChIKey | OHNMABALIOWWMV-GJZGRUSLSA-N |
| XLogP | 1.52 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|