C20H20N6 — CID 902368
(8R,8aR)-6-amino-2-propyl-8-pyridin-4-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 902368) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is (8R,8aR)-6-amino-2-propyl-8-pyridin-4-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-6-amino-2-propyl-8-pyridin-4-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 902368 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (8R,8aR)-6-amino-2-propyl-8-pyridin-4-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CCCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@@H](c3ccncc3)[C@H]2C1 |
| InChI | InChI=1S/C20H20N6/c1-2-8-26-9-5-15-16(10-21)19(24)20(12-22,13-23)18(17(15)11-26)14-3-6-25-7-4-14/h3-7,17-18H,2,8-9,11,24H2,1H3/t17-,18-/m0/s1 |
| InChIKey | DUWXQJJAEFVDQG-ROUUACIJSA-N |
| XLogP | 2.22 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|