C28H23N5O5 — CID 35209002
benzyl (8S,8aS)-6-amino-5,7,7-tricyano-8-(7-methoxy-1,3-benzodioxol-5-yl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 35209002) has the molecular formula C28H23N5O5 and a molecular weight of 509.52 g/mol. Its IUPAC name is benzyl (8S,8aS)-6-amino-5,7,7-tricyano-8-(7-methoxy-1,3-benzodioxol-5-yl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | benzyl (8S,8aS)-6-amino-5,7,7-tricyano-8-(7-methoxy-1,3-benzodioxol-5-yl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 35209002 |
| Molecular Formula | C28H23N5O5 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | benzyl (8S,8aS)-6-amino-5,7,7-tricyano-8-(7-methoxy-1,3-benzodioxol-5-yl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | COc1cc([C@@H]2[C@@H]3CN(C(=O)OCc4ccccc4)CC=C3C(C#N)=C(N)C2(C#N)C#N)cc2c1OCO2 |
| InChI | InChI=1S/C28H23N5O5/c1-35-22-9-18(10-23-25(22)38-16-37-23)24-21-12-33(27(34)36-13-17-5-3-2-4-6-17)8-7-19(21)20(11-29)26(32)28(24,14-30)15-31/h2-7,9-10,21,24H,8,12-13,16,32H2,1H3/t21-,24-/m1/s1 |
| InChIKey | NEVQIXZWCJANKD-ZJSXRUAMSA-N |
| XLogP | 3.49 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|