C27H20F3N5O3 — CID 92509007
benzyl (8R,8aS)-6-amino-5,7,7-tricyano-8-[4-(trifluoromethoxy)phenyl]-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 92509007) has the molecular formula C27H20F3N5O3 and a molecular weight of 519.48 g/mol. Its IUPAC name is benzyl (8R,8aS)-6-amino-5,7,7-tricyano-8-[4-(trifluoromethoxy)phenyl]-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | benzyl (8R,8aS)-6-amino-5,7,7-tricyano-8-[4-(trifluoromethoxy)phenyl]-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 92509007 |
| Molecular Formula | C27H20F3N5O3 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | benzyl (8R,8aS)-6-amino-5,7,7-tricyano-8-[4-(trifluoromethoxy)phenyl]-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2ccc(OC(F)(F)F)cc2)[C@@H]2CN(C(=O)OCc3ccccc3)CC=C12 |
| InChI | InChI=1S/C27H20F3N5O3/c28-27(29,30)38-19-8-6-18(7-9-19)23-22-13-35(25(36)37-14-17-4-2-1-3-5-17)11-10-20(22)21(12-31)24(34)26(23,15-32)16-33/h1-10,22-23H,11,13-14,34H2/t22-,23+/m1/s1 |
| InChIKey | DWJASUIPYPDUKM-PKTZIBPZSA-N |
| XLogP | 4.65 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|