C26H19Cl2N5O2 — CID 3602560
benzyl 6-amino-5,7,7-tricyano-8-(2,6-dichlorophenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 3602560) has the molecular formula C26H19Cl2N5O2 and a molecular weight of 504.38 g/mol. Its IUPAC name is benzyl 6-amino-5,7,7-tricyano-8-(2,6-dichlorophenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | benzyl 6-amino-5,7,7-tricyano-8-(2,6-dichlorophenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 3602560 |
| Molecular Formula | C26H19Cl2N5O2 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | benzyl 6-amino-5,7,7-tricyano-8-(2,6-dichlorophenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2c(Cl)cccc2Cl)C2CN(C(=O)OCc3ccccc3)CC=C12 |
| InChI | InChI=1S/C26H19Cl2N5O2/c27-20-7-4-8-21(28)22(20)23-19-12-33(25(34)35-13-16-5-2-1-3-6-16)10-9-17(19)18(11-29)24(32)26(23,14-30)15-31/h1-9,19,23H,10,12-13,32H2 |
| InChIKey | KKRKWBUFJPVDCO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|