C26H20N6O4 — CID 6560554
benzyl (8R,8aS)-6-amino-5,7,7-tricyano-8-(4-nitrophenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 6560554) has the molecular formula C26H20N6O4 and a molecular weight of 480.48 g/mol. Its IUPAC name is benzyl (8R,8aS)-6-amino-5,7,7-tricyano-8-(4-nitrophenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | benzyl (8R,8aS)-6-amino-5,7,7-tricyano-8-(4-nitrophenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 6560554 |
| Molecular Formula | C26H20N6O4 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | benzyl (8R,8aS)-6-amino-5,7,7-tricyano-8-(4-nitrophenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2ccc([N+](=O)[O-])cc2)[C@@H]2CN(C(=O)OCc3ccccc3)CC=C12 |
| InChI | InChI=1S/C26H20N6O4/c27-12-21-20-10-11-31(25(33)36-14-17-4-2-1-3-5-17)13-22(20)23(26(15-28,16-29)24(21)30)18-6-8-19(9-7-18)32(34)35/h1-10,22-23H,11,13-14,30H2/t22-,23+/m1/s1 |
| InChIKey | DMERSPWLMYWCRX-PKTZIBPZSA-N |
| XLogP | 3.66 |
| TPSA | 170.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|