C26H20ClN5O2 — CID 40938742
benzyl (8R,8aS)-6-amino-8-(3-chlorophenyl)-5,7,7-tricyano-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 40938742) has the molecular formula C26H20ClN5O2 and a molecular weight of 469.93 g/mol. Its IUPAC name is benzyl (8R,8aS)-6-amino-8-(3-chlorophenyl)-5,7,7-tricyano-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | benzyl (8R,8aS)-6-amino-8-(3-chlorophenyl)-5,7,7-tricyano-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 40938742 |
| Molecular Formula | C26H20ClN5O2 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | benzyl (8R,8aS)-6-amino-8-(3-chlorophenyl)-5,7,7-tricyano-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2cccc(Cl)c2)[C@@H]2CN(C(=O)OCc3ccccc3)CC=C12 |
| InChI | InChI=1S/C26H20ClN5O2/c27-19-8-4-7-18(11-19)23-22-13-32(25(33)34-14-17-5-2-1-3-6-17)10-9-20(22)21(12-28)24(31)26(23,15-29)16-30/h1-9,11,22-23H,10,13-14,31H2/t22-,23+/m1/s1 |
| InChIKey | BQMUHWORHIZDNO-PKTZIBPZSA-N |
| XLogP | 4.40 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|