C31H32N4O2 — CID 98371131
(4S,4aS,6S)-2-amino-6-tert-butyl-4-(3-methoxy-4-phenylmethoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 98371131) has the molecular formula C31H32N4O2 and a molecular weight of 492.62 g/mol. Its IUPAC name is (4S,4aS,6S)-2-amino-6-tert-butyl-4-(3-methoxy-4-phenylmethoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4S,4aS,6S)-2-amino-6-tert-butyl-4-(3-methoxy-4-phenylmethoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 98371131 |
| Molecular Formula | C31H32N4O2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (4S,4aS,6S)-2-amino-6-tert-butyl-4-(3-methoxy-4-phenylmethoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | COc1cc([C@@H]2[C@@H]3C[C@@H](C(C)(C)C)CC=C3C(C#N)=C(N)C2(C#N)C#N)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H32N4O2/c1-30(2,3)22-11-12-23-24(15-22)28(31(18-33,19-34)29(35)25(23)16-32)21-10-13-26(27(14-21)36-4)37-17-20-8-6-5-7-9-20/h5-10,12-14,22,24,28H,11,15,17,35H2,1-4H3/t22-,24+,28+/m0/s1 |
| InChIKey | OUUABTOZVPYXLW-ZQIDGUAPSA-N |
| XLogP | 6.14 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|