C21H21N3O2 — CID 11859201
ethyl (1R,2S,4R,8aS)-2,4-dicyano-3-imino-1-phenyl-1,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate (PubChem CID 11859201) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl (1R,2S,4R,8aS)-2,4-dicyano-3-imino-1-phenyl-1,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate.
| Compound Name | ethyl (1R,2S,4R,8aS)-2,4-dicyano-3-imino-1-phenyl-1,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11859201 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethyl (1R,2S,4R,8aS)-2,4-dicyano-3-imino-1-phenyl-1,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate |
| SMILES | [H]/N=C1\[C@H](C#N)C2=CCCC[C@H]2[C@H](c2ccccc2)[C@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C21H21N3O2/c1-2-26-20(25)21(13-23)18(14-8-4-3-5-9-14)16-11-7-6-10-15(16)17(12-22)19(21)24/h3-5,8-10,16-18,24H,2,6-7,11H2,1H3/b24-19+/t16-,17-,18+,21+/m1/s1 |
| InChIKey | MMOHRNLJHGTZFZ-IZWGJUOHSA-N |
| XLogP | 3.74 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|