C22H23N3O3 — CID 7358690
ethyl (1R,2S,8aS)-2,3-dicyano-4-imino-1-(2-methoxyphenyl)-1,3,6,7,8,8a-hexahydronaphthalene-2-carboxylate (PubChem CID 7358690) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is ethyl (1R,2S,8aS)-2,3-dicyano-4-imino-1-(2-methoxyphenyl)-1,3,6,7,8,8a-hexahydronaphthalene-2-carboxylate.
| Compound Name | ethyl (1R,2S,8aS)-2,3-dicyano-4-imino-1-(2-methoxyphenyl)-1,3,6,7,8,8a-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7358690 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | ethyl (1R,2S,8aS)-2,3-dicyano-4-imino-1-(2-methoxyphenyl)-1,3,6,7,8,8a-hexahydronaphthalene-2-carboxylate |
| SMILES | [H]/N=C1\C2=CCCC[C@H]2[C@H](c2ccccc2OC)[C@](C#N)(C(=O)OCC)C1C#N |
| InChI | InChI=1S/C22H23N3O3/c1-3-28-21(26)22(13-24)17(12-23)20(25)15-9-5-4-8-14(15)19(22)16-10-6-7-11-18(16)27-2/h6-7,9-11,14,17,19,25H,3-5,8H2,1-2H3/b25-20+/t14-,17?,19-,22-/m1/s1 |
| InChIKey | MQBLLWQJNAVDCE-ZGSHILGDSA-N |
| XLogP | 3.75 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|