C24H20N4O — CID 92770556
(4R,4aS)-2-amino-4-(2-methoxynaphthalen-1-yl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 92770556) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is (4R,4aS)-2-amino-4-(2-methoxynaphthalen-1-yl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4R,4aS)-2-amino-4-(2-methoxynaphthalen-1-yl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 92770556 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (4R,4aS)-2-amino-4-(2-methoxynaphthalen-1-yl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | COc1ccc2ccccc2c1[C@@H]1[C@@H]2CCCC=C2C(C#N)=C(N)C1(C#N)C#N |
| InChI | InChI=1S/C24H20N4O/c1-29-20-11-10-15-6-2-3-7-16(15)21(20)22-18-9-5-4-8-17(18)19(12-25)23(28)24(22,13-26)14-27/h2-3,6-8,10-11,18,22H,4-5,9,28H2,1H3/t18-,22+/m1/s1 |
| InChIKey | OEKXENXHVRZOAL-GCJKJVERSA-N |
| XLogP | 4.44 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|