C21H22N5O+ — CID 7241422
(7S,8S,8aR)-2-ethyl-6-imino-8-(2-methoxyphenyl)-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile (PubChem CID 7241422) has the molecular formula C21H22N5O+ and a molecular weight of 360.44 g/mol. Its IUPAC name is (7S,8S,8aR)-2-ethyl-6-imino-8-(2-methoxyphenyl)-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile.
| Compound Name | (7S,8S,8aR)-2-ethyl-6-imino-8-(2-methoxyphenyl)-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 7241422 |
| Molecular Formula | C21H22N5O+ |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (7S,8S,8aR)-2-ethyl-6-imino-8-(2-methoxyphenyl)-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)[C@@H](c2ccccc2OC)[C@H]2C[NH+](CC)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C21H21N5O/c1-3-26-9-8-17-16(11-26)19(14-6-4-5-7-18(14)27-2)15(10-22)20(25)21(17,12-23)13-24/h4-8,15-16,19,25H,3,9,11H2,1-2H3/p+1/b25-20+/t15-,16-,19+/m0/s1 |
| InChIKey | FKAODWMTHCQCFB-JDULYBFHSA-O |
| XLogP | 1.45 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|