C22H21N5O2 — CID 7307329
methyl 4-[(7S,8S,8aR)-5,5,7-tricyano-2-ethyl-6-imino-3,7,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate (PubChem CID 7307329) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 4-[(7S,8S,8aR)-5,5,7-tricyano-2-ethyl-6-imino-3,7,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate.
| Compound Name | methyl 4-[(7S,8S,8aR)-5,5,7-tricyano-2-ethyl-6-imino-3,7,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate |
|---|---|
| PubChem CID | 7307329 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | methyl 4-[(7S,8S,8aR)-5,5,7-tricyano-2-ethyl-6-imino-3,7,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate |
| SMILES | [H]/N=C1\[C@@H](C#N)[C@@H](c2ccc(C(=O)OC)cc2)[C@H]2CN(CC)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C22H21N5O2/c1-3-27-9-8-18-17(11-27)19(14-4-6-15(7-5-14)21(28)29-2)16(10-23)20(26)22(18,12-24)13-25/h4-8,16-17,19,26H,3,9,11H2,1-2H3/b26-20+/t16-,17-,19+/m0/s1 |
| InChIKey | PCSIKCVFRNRBPS-DOVCCBQNSA-N |
| XLogP | 2.64 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|