C19H16FN5 — CID 7711966
(7R,8R,8aR)-8-(2-fluorophenyl)-6-imino-2-methyl-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile (PubChem CID 7711966) has the molecular formula C19H16FN5 and a molecular weight of 333.37 g/mol. Its IUPAC name is (7R,8R,8aR)-8-(2-fluorophenyl)-6-imino-2-methyl-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile.
| Compound Name | (7R,8R,8aR)-8-(2-fluorophenyl)-6-imino-2-methyl-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 7711966 |
| Molecular Formula | C19H16FN5 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (7R,8R,8aR)-8-(2-fluorophenyl)-6-imino-2-methyl-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)[C@H](c2ccccc2F)[C@H]2CN(C)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C19H16FN5/c1-25-7-6-15-14(9-25)17(12-4-2-3-5-16(12)20)13(8-21)18(24)19(15,10-22)11-23/h2-6,13-14,17,24H,7,9H2,1H3/b24-18+/t13-,14+,17+/m1/s1 |
| InChIKey | XSYSERVMSGYQBV-KTRSRKKOSA-N |
| XLogP | 2.60 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|