C22H21F3N5+ — CID 7708006
(7R,8S,8aS)-6-imino-2-propan-2-yl-8-[2-(trifluoromethyl)phenyl]-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile (PubChem CID 7708006) has the molecular formula C22H21F3N5+ and a molecular weight of 412.44 g/mol. Its IUPAC name is (7R,8S,8aS)-6-imino-2-propan-2-yl-8-[2-(trifluoromethyl)phenyl]-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile.
| Compound Name | (7R,8S,8aS)-6-imino-2-propan-2-yl-8-[2-(trifluoromethyl)phenyl]-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 7708006 |
| Molecular Formula | C22H21F3N5+ |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (7R,8S,8aS)-6-imino-2-propan-2-yl-8-[2-(trifluoromethyl)phenyl]-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)[C@@H](c2ccccc2C(F)(F)F)[C@@H]2C[NH+](C(C)C)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C22H20F3N5/c1-13(2)30-8-7-17-16(10-30)19(14-5-3-4-6-18(14)22(23,24)25)15(9-26)20(29)21(17,11-27)12-28/h3-7,13,15-16,19,29H,8,10H2,1-2H3/p+1/b29-20+/t15-,16-,19-/m1/s1 |
| InChIKey | ZDUFBENERBGDQS-NWAMTODLSA-O |
| XLogP | 2.85 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|