C16H11ClN4S2 — CID 7236577
(8R,8aR)-8-(5-chlorothiophen-2-yl)-6-imino-3,7,8,8a-tetrahydro-1H-isothiochromene-5,5,7-tricarbonitrile (PubChem CID 7236577) has the molecular formula C16H11ClN4S2 and a molecular weight of 358.88 g/mol. Its IUPAC name is (8R,8aR)-8-(5-chlorothiophen-2-yl)-6-imino-3,7,8,8a-tetrahydro-1H-isothiochromene-5,5,7-tricarbonitrile.
| Compound Name | (8R,8aR)-8-(5-chlorothiophen-2-yl)-6-imino-3,7,8,8a-tetrahydro-1H-isothiochromene-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 7236577 |
| Molecular Formula | C16H11ClN4S2 |
| Molecular Weight | 358.88 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | (8R,8aR)-8-(5-chlorothiophen-2-yl)-6-imino-3,7,8,8a-tetrahydro-1H-isothiochromene-5,5,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)[C@@H](c2ccc(Cl)s2)[C@H]2CSCC=C2C1(C#N)C#N |
| InChI | InChI=1S/C16H11ClN4S2/c17-13-2-1-12(23-13)14-9(5-18)15(21)16(7-19,8-20)11-3-4-22-6-10(11)14/h1-3,9-10,14,21H,4,6H2/b21-15+/t9?,10-,14+/m0/s1 |
| InChIKey | QLIIEINRHGOSSF-KPGJXBTQSA-N |
| XLogP | 3.98 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|