C21H21ClN4S — CID 7236578
(3R,4S,4aS,6S)-6-tert-butyl-4-(5-chlorothiophen-2-yl)-2-imino-3,4,4a,5,6,7-hexahydronaphthalene-1,1,3-tricarbonitrile (PubChem CID 7236578) has the molecular formula C21H21ClN4S and a molecular weight of 396.95 g/mol. Its IUPAC name is (3R,4S,4aS,6S)-6-tert-butyl-4-(5-chlorothiophen-2-yl)-2-imino-3,4,4a,5,6,7-hexahydronaphthalene-1,1,3-tricarbonitrile.
| Compound Name | (3R,4S,4aS,6S)-6-tert-butyl-4-(5-chlorothiophen-2-yl)-2-imino-3,4,4a,5,6,7-hexahydronaphthalene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 7236578 |
| Molecular Formula | C21H21ClN4S |
| Molecular Weight | 396.95 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (3R,4S,4aS,6S)-6-tert-butyl-4-(5-chlorothiophen-2-yl)-2-imino-3,4,4a,5,6,7-hexahydronaphthalene-1,1,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)[C@@H](c2ccc(Cl)s2)[C@@H]2C[C@@H](C(C)(C)C)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C21H21ClN4S/c1-20(2,3)12-4-5-15-13(8-12)18(16-6-7-17(22)27-16)14(9-23)19(26)21(15,10-24)11-25/h5-7,12-14,18,26H,4,8H2,1-3H3/b26-19+/t12-,13+,14+,18-/m0/s1 |
| InChIKey | YFNJTLSXMMOCMQ-DKZGPQSJSA-N |
| XLogP | 5.69 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.95 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|