C20H18FN5 — CID 74534931
2-ethyl-8-(4-fluorophenyl)-6-imino-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile (PubChem CID 74534931) has the molecular formula C20H18FN5 and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-ethyl-8-(4-fluorophenyl)-6-imino-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile.
| Compound Name | 2-ethyl-8-(4-fluorophenyl)-6-imino-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 74534931 |
| Molecular Formula | C20H18FN5 |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-ethyl-8-(4-fluorophenyl)-6-imino-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C(c2ccc(F)cc2)C2CN(CC)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C20H18FN5/c1-2-26-8-7-17-16(10-26)18(13-3-5-14(21)6-4-13)15(9-22)19(25)20(17,11-23)12-24/h3-7,15-16,18,25H,2,8,10H2,1H3/b25-19+ |
| InChIKey | MIOZMXKCIOWEPQ-NCELDCMTSA-N |
| XLogP | 2.99 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|