C20H18ClN5 — CID 51667347
(8R,8aS)-6-amino-8-(4-chlorophenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile (PubChem CID 51667347) has the molecular formula C20H18ClN5 and a molecular weight of 363.85 g/mol. Its IUPAC name is (8R,8aS)-6-amino-8-(4-chlorophenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-amino-8-(4-chlorophenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 51667347 |
| Molecular Formula | C20H18ClN5 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (8R,8aS)-6-amino-8-(4-chlorophenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
| SMILES | CCN1CC=C2[C@@H](C1)[C@H](c1ccc(Cl)cc1)C(C#N)=C(N)C2(C#N)C#N |
| InChI | InChI=1S/C20H18ClN5/c1-2-26-8-7-17-16(10-26)18(13-3-5-14(21)6-4-13)15(9-22)19(25)20(17,11-23)12-24/h3-7,16,18H,2,8,10,25H2,1H3/t16-,18-/m1/s1 |
| InChIKey | VHRXMNZCQHBQEN-SJLPKXTDSA-N |
| XLogP | 3.09 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|