C22H22N4 — CID 51404831
(4R,4aS,6R)-2-amino-4-(4-ethylphenyl)-6-methyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile (PubChem CID 51404831) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is (4R,4aS,6R)-2-amino-4-(4-ethylphenyl)-6-methyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile.
| Compound Name | (4R,4aS,6R)-2-amino-4-(4-ethylphenyl)-6-methyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 51404831 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (4R,4aS,6R)-2-amino-4-(4-ethylphenyl)-6-methyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile |
| SMILES | CCc1ccc([C@@H]2C(C#N)=C(N)C(C#N)(C#N)C3=CC[C@@H](C)C[C@H]32)cc1 |
| InChI | InChI=1S/C22H22N4/c1-3-15-5-7-16(8-6-15)20-17-10-14(2)4-9-19(17)22(12-24,13-25)21(26)18(20)11-23/h5-9,14,17,20H,3-4,10,26H2,1-2H3/t14-,17-,20+/m1/s1 |
| InChIKey | OTQGRWKTNXXLPH-ZTQAJYAQSA-N |
| XLogP | 4.09 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|