C18H16ClN5S — CID 6547749
(8R,8aR)-6-amino-8-(5-chlorothiophen-2-yl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile (PubChem CID 6547749) has the molecular formula C18H16ClN5S and a molecular weight of 369.88 g/mol. Its IUPAC name is (8R,8aR)-6-amino-8-(5-chlorothiophen-2-yl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile.
| Compound Name | (8R,8aR)-6-amino-8-(5-chlorothiophen-2-yl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 6547749 |
| Molecular Formula | C18H16ClN5S |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (8R,8aR)-6-amino-8-(5-chlorothiophen-2-yl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
| SMILES | CCN1CC=C2[C@H](C1)[C@@H](c1ccc(Cl)s1)C(C#N)=C(N)C2(C#N)C#N |
| InChI | InChI=1S/C18H16ClN5S/c1-2-24-6-5-13-12(8-24)16(14-3-4-15(19)25-14)11(7-20)17(23)18(13,9-21)10-22/h3-5,12,16H,2,6,8,23H2,1H3/t12-,16-/m0/s1 |
| InChIKey | JMGUNBRJOCQPKP-LRDDRELGSA-N |
| XLogP | 3.15 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|