C22H20F3N5 — CID 51665430
(8R,8aS)-6-amino-2-propan-2-yl-8-[2-(trifluoromethyl)phenyl]-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile (PubChem CID 51665430) has the molecular formula C22H20F3N5 and a molecular weight of 411.43 g/mol. Its IUPAC name is (8R,8aS)-6-amino-2-propan-2-yl-8-[2-(trifluoromethyl)phenyl]-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-amino-2-propan-2-yl-8-[2-(trifluoromethyl)phenyl]-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 51665430 |
| Molecular Formula | C22H20F3N5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (8R,8aS)-6-amino-2-propan-2-yl-8-[2-(trifluoromethyl)phenyl]-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
| SMILES | CC(C)N1CC=C2[C@@H](C1)[C@H](c1ccccc1C(F)(F)F)C(C#N)=C(N)C2(C#N)C#N |
| InChI | InChI=1S/C22H20F3N5/c1-13(2)30-8-7-17-16(10-30)19(14-5-3-4-6-18(14)22(23,24)25)15(9-26)20(29)21(17,11-27)12-28/h3-7,13,16,19H,8,10,29H2,1-2H3/t16-,19-/m1/s1 |
| InChIKey | APYTWXMHKZUJOM-VQIMIIECSA-N |
| XLogP | 3.84 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|