C21H20BrN5 — CID 4188971
6-amino-8-(3-bromophenyl)-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile (PubChem CID 4188971) has the molecular formula C21H20BrN5 and a molecular weight of 422.33 g/mol. Its IUPAC name is 6-amino-8-(3-bromophenyl)-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile.
| Compound Name | 6-amino-8-(3-bromophenyl)-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 4188971 |
| Molecular Formula | C21H20BrN5 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 6-amino-8-(3-bromophenyl)-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
| SMILES | CCCN1CC=C2C(C1)C(c1cccc(Br)c1)C(C#N)=C(N)C2(C#N)C#N |
| InChI | InChI=1S/C21H20BrN5/c1-2-7-27-8-6-18-17(11-27)19(14-4-3-5-15(22)9-14)16(10-23)20(26)21(18,12-24)13-25/h3-6,9,17,19H,2,7-8,11,26H2,1H3 |
| InChIKey | ARRIRAODOMDOOX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|