C27H32N4O2 — CID 51443663
(4S,4aR,6R)-2-amino-6-tert-butyl-4-(4-methoxy-3-propan-2-yloxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile (PubChem CID 51443663) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is (4S,4aR,6R)-2-amino-6-tert-butyl-4-(4-methoxy-3-propan-2-yloxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile.
| Compound Name | (4S,4aR,6R)-2-amino-6-tert-butyl-4-(4-methoxy-3-propan-2-yloxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 51443663 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (4S,4aR,6R)-2-amino-6-tert-butyl-4-(4-methoxy-3-propan-2-yloxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile |
| SMILES | COc1ccc([C@H]2C(C#N)=C(N)C(C#N)(C#N)C3=CC[C@@H](C(C)(C)C)C[C@@H]32)cc1OC(C)C |
| InChI | InChI=1S/C27H32N4O2/c1-16(2)33-23-11-17(7-10-22(23)32-6)24-19-12-18(26(3,4)5)8-9-21(19)27(14-29,15-30)25(31)20(24)13-28/h7,9-11,16,18-19,24H,8,12,31H2,1-6H3/t18-,19+,24-/m1/s1 |
| InChIKey | XVXPKJWNTPVABE-YDIMBITNSA-N |
| XLogP | 5.35 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|