C23H22FN5O2 — CID 6965408
tert-butyl (7R,8R,8aS)-5,5,7-tricyano-8-(3-fluorophenyl)-6-imino-3,7,8,8a-tetrahydro-1H-isoquinoline-2-carboxylate (PubChem CID 6965408) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is tert-butyl (7R,8R,8aS)-5,5,7-tricyano-8-(3-fluorophenyl)-6-imino-3,7,8,8a-tetrahydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (7R,8R,8aS)-5,5,7-tricyano-8-(3-fluorophenyl)-6-imino-3,7,8,8a-tetrahydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 6965408 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | tert-butyl (7R,8R,8aS)-5,5,7-tricyano-8-(3-fluorophenyl)-6-imino-3,7,8,8a-tetrahydro-1H-isoquinoline-2-carboxylate |
| SMILES | [H]/N=C1\[C@H](C#N)[C@H](c2cccc(F)c2)[C@@H]2CN(C(=O)OC(C)(C)C)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C23H22FN5O2/c1-22(2,3)31-21(30)29-8-7-18-17(11-29)19(14-5-4-6-15(24)9-14)16(10-25)20(28)23(18,12-26)13-27/h4-7,9,16-17,19,28H,8,11H2,1-3H3/b28-20+/t16-,17-,19+/m1/s1 |
| InChIKey | KZJGTMYJAKFEJI-JKDIALGXSA-N |
| XLogP | 3.91 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|