C22H23FN2OS — CID 7358724
(4R,5S)-5-(adamantane-1-carbonyl)-4-(3-fluorophenyl)-2-iminothiolane-3-carbonitrile (PubChem CID 7358724) has the molecular formula C22H23FN2OS and a molecular weight of 382.50 g/mol. Its IUPAC name is (4R,5S)-5-(adamantane-1-carbonyl)-4-(3-fluorophenyl)-2-iminothiolane-3-carbonitrile.
| Compound Name | (4R,5S)-5-(adamantane-1-carbonyl)-4-(3-fluorophenyl)-2-iminothiolane-3-carbonitrile |
|---|---|
| PubChem CID | 7358724 |
| Molecular Formula | C22H23FN2OS |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (4R,5S)-5-(adamantane-1-carbonyl)-4-(3-fluorophenyl)-2-iminothiolane-3-carbonitrile |
| SMILES | [H]/N=C1\S[C@H](C(=O)C23CC4CC(CC(C4)C2)C3)[C@@H](c2cccc(F)c2)C1C#N |
| InChI | InChI=1S/C22H23FN2OS/c23-16-3-1-2-15(7-16)18-17(11-24)21(25)27-19(18)20(26)22-8-12-4-13(9-22)6-14(5-12)10-22/h1-3,7,12-14,17-19,25H,4-6,8-10H2/b25-21-/t12?,13?,14?,17?,18-,19-,22?/m0/s1 |
| InChIKey | DKTXIZULMHRNLA-DOVPEKGWSA-N |
| XLogP | 4.93 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|