C19H19N5S — CID 6949077
(7R,8S,8aS)-6-imino-2-propyl-8-thiophen-3-yl-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile (PubChem CID 6949077) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is (7R,8S,8aS)-6-imino-2-propyl-8-thiophen-3-yl-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile.
| Compound Name | (7R,8S,8aS)-6-imino-2-propyl-8-thiophen-3-yl-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 6949077 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (7R,8S,8aS)-6-imino-2-propyl-8-thiophen-3-yl-3,7,8,8a-tetrahydro-1H-isoquinoline-5,5,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)[C@@H](c2ccsc2)[C@@H]2CN(CCC)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C19H19N5S/c1-2-5-24-6-3-16-15(9-24)17(13-4-7-25-10-13)14(8-20)18(23)19(16,11-21)12-22/h3-4,7,10,14-15,17,23H,2,5-6,9H2,1H3/b23-18+/t14-,15-,17-/m1/s1 |
| InChIKey | SUNONIKPRYHIKA-ZOKFASHYSA-N |
| XLogP | 3.31 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|