C20H19ClN5+ — CID 7236410
(7S,8S,8aR)-8-(4-chlorophenyl)-2-ethyl-6-imino-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile (PubChem CID 7236410) has the molecular formula C20H19ClN5+ and a molecular weight of 364.86 g/mol. Its IUPAC name is (7S,8S,8aR)-8-(4-chlorophenyl)-2-ethyl-6-imino-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile.
| Compound Name | (7S,8S,8aR)-8-(4-chlorophenyl)-2-ethyl-6-imino-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 7236410 |
| Molecular Formula | C20H19ClN5+ |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (7S,8S,8aR)-8-(4-chlorophenyl)-2-ethyl-6-imino-1,2,3,7,8,8a-hexahydroisoquinolin-2-ium-5,5,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)[C@@H](c2ccc(Cl)cc2)[C@H]2C[NH+](CC)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C20H18ClN5/c1-2-26-8-7-17-16(10-26)18(13-3-5-14(21)6-4-13)15(9-22)19(25)20(17,11-23)12-24/h3-7,15-16,18,25H,2,8,10H2,1H3/p+1/b25-19+/t15-,16-,18+/m0/s1 |
| InChIKey | CTVKKKDUTVIVRD-NPIFKOQBSA-O |
| XLogP | 2.09 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|