C23H23N5O2 — CID 7409161
methyl 4-[(7S,8S,8aR)-5,5,7-tricyano-6-imino-2-propan-2-yl-3,7,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate (PubChem CID 7409161) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is methyl 4-[(7S,8S,8aR)-5,5,7-tricyano-6-imino-2-propan-2-yl-3,7,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate.
| Compound Name | methyl 4-[(7S,8S,8aR)-5,5,7-tricyano-6-imino-2-propan-2-yl-3,7,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate |
|---|---|
| PubChem CID | 7409161 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | methyl 4-[(7S,8S,8aR)-5,5,7-tricyano-6-imino-2-propan-2-yl-3,7,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate |
| SMILES | [H]/N=C1\[C@@H](C#N)[C@@H](c2ccc(C(=O)OC)cc2)[C@H]2CN(C(C)C)CC=C2C1(C#N)C#N |
| InChI | InChI=1S/C23H23N5O2/c1-14(2)28-9-8-19-18(11-28)20(15-4-6-16(7-5-15)22(29)30-3)17(10-24)21(27)23(19,12-25)13-26/h4-8,14,17-18,20,27H,9,11H2,1-3H3/b27-21+/t17-,18-,20+/m0/s1 |
| InChIKey | TWGWEWVXMGUAJN-FOKIQCKXSA-N |
| XLogP | 3.03 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|