C21H22N5O+ — CID 7236174
(8R,8aR)-8-(3-hydroxyphenyl)-6-imino-2-propan-2-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 7236174) has the molecular formula C21H22N5O+ and a molecular weight of 360.44 g/mol. Its IUPAC name is (8R,8aR)-8-(3-hydroxyphenyl)-6-imino-2-propan-2-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-8-(3-hydroxyphenyl)-6-imino-2-propan-2-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7236174 |
| Molecular Formula | C21H22N5O+ |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (8R,8aR)-8-(3-hydroxyphenyl)-6-imino-2-propan-2-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](C(C)C)C[C@@H]2[C@H](c2cccc(O)c2)C1(C#N)C#N |
| InChI | InChI=1S/C21H21N5O/c1-13(2)26-7-6-16-17(9-22)20(25)21(11-23,12-24)19(18(16)10-26)14-4-3-5-15(27)8-14/h3-6,8,13,17-19,25,27H,7,10H2,1-2H3/p+1/b25-20+/t17?,18-,19-/m0/s1 |
| InChIKey | XQGPLIRNPSYRHK-QZMIAFNMSA-O |
| XLogP | 1.53 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|