C25H23N3O2 — CID 51614369
ethyl (1R,2S,8aS)-3-amino-2,4-dicyano-1-naphthalen-1-yl-6,7,8,8a-tetrahydro-1H-naphthalene-2-carboxylate (PubChem CID 51614369) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethyl (1R,2S,8aS)-3-amino-2,4-dicyano-1-naphthalen-1-yl-6,7,8,8a-tetrahydro-1H-naphthalene-2-carboxylate.
| Compound Name | ethyl (1R,2S,8aS)-3-amino-2,4-dicyano-1-naphthalen-1-yl-6,7,8,8a-tetrahydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 51614369 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ethyl (1R,2S,8aS)-3-amino-2,4-dicyano-1-naphthalen-1-yl-6,7,8,8a-tetrahydro-1H-naphthalene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)C(N)=C(C#N)C2=CCCC[C@H]2[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C25H23N3O2/c1-2-30-24(29)25(15-27)22(19-13-7-9-16-8-3-4-10-17(16)19)20-12-6-5-11-18(20)21(14-26)23(25)28/h3-4,7-11,13,20,22H,2,5-6,12,28H2,1H3/t20-,22+,25+/m1/s1 |
| InChIKey | XGDGFATYQMYRDA-KJWPAHLWSA-N |
| XLogP | 4.47 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |