C24H27N3O2 — CID 51682615
ethyl (1R,2S,8S)-3-amino-2,4-dicyano-6,6,8-trimethyl-1-phenyl-1,5,7,8-tetrahydronaphthalene-2-carboxylate (PubChem CID 51682615) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is ethyl (1R,2S,8S)-3-amino-2,4-dicyano-6,6,8-trimethyl-1-phenyl-1,5,7,8-tetrahydronaphthalene-2-carboxylate.
| Compound Name | ethyl (1R,2S,8S)-3-amino-2,4-dicyano-6,6,8-trimethyl-1-phenyl-1,5,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 51682615 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | ethyl (1R,2S,8S)-3-amino-2,4-dicyano-6,6,8-trimethyl-1-phenyl-1,5,7,8-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)C(N)=C(C#N)C2=C([C@@H](C)CC(C)(C)C2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H27N3O2/c1-5-29-22(28)24(14-26)20(16-9-7-6-8-10-16)19-15(2)11-23(3,4)12-17(19)18(13-25)21(24)27/h6-10,15,20H,5,11-12,27H2,1-4H3/t15-,20+,24-/m0/s1 |
| InChIKey | VZDYFOCXVQNZFM-VNJOCVIMSA-N |
| XLogP | 4.35 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |