C17H14BrN5S — CID 7241334
(8S,8aR)-8-(5-bromothiophen-2-yl)-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile (PubChem CID 7241334) has the molecular formula C17H14BrN5S and a molecular weight of 400.31 g/mol. Its IUPAC name is (8S,8aR)-8-(5-bromothiophen-2-yl)-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aR)-8-(5-bromothiophen-2-yl)-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7241334 |
| Molecular Formula | C17H14BrN5S |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | (8S,8aR)-8-(5-bromothiophen-2-yl)-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CCN(C)C[C@@H]2[C@H](c2ccc(Br)s2)C1(C#N)C#N |
| InChI | InChI=1S/C17H14BrN5S/c1-23-5-4-10-11(6-19)16(22)17(8-20,9-21)15(12(10)7-23)13-2-3-14(18)24-13/h2-4,11-12,15,22H,5,7H2,1H3/b22-16+/t11?,12-,15+/m0/s1 |
| InChIKey | PFVVQFOUQLCMDQ-MWWIMTEMSA-N |
| XLogP | 3.29 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|