C20H18N4 — CID 7307422
(4R,4aR,7S)-2-imino-7-methyl-4-phenyl-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile (PubChem CID 7307422) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is (4R,4aR,7S)-2-imino-7-methyl-4-phenyl-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4R,4aR,7S)-2-imino-7-methyl-4-phenyl-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 7307422 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (4R,4aR,7S)-2-imino-7-methyl-4-phenyl-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=C[C@@H](C)CC[C@@H]2[C@H](c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C20H18N4/c1-13-7-8-15-16(9-13)17(10-21)19(24)20(11-22,12-23)18(15)14-5-3-2-4-6-14/h2-6,9,13,15,17-18,24H,7-8H2,1H3/b24-19+/t13-,15-,17?,18-/m0/s1 |
| InChIKey | BDDCNVNYOPTFFD-WJOHTKRWSA-N |
| XLogP | 3.95 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|