C21H22N5+ — CID 7113784
(3S,5R,8S,8aS)-6-imino-2,3,8a-trimethyl-8-phenyl-2,3,5,8-tetrahydro-1H-isoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 7113784) has the molecular formula C21H22N5+ and a molecular weight of 344.44 g/mol. Its IUPAC name is (3S,5R,8S,8aS)-6-imino-2,3,8a-trimethyl-8-phenyl-2,3,5,8-tetrahydro-1H-isoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (3S,5R,8S,8aS)-6-imino-2,3,8a-trimethyl-8-phenyl-2,3,5,8-tetrahydro-1H-isoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7113784 |
| Molecular Formula | C21H22N5+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (3S,5R,8S,8aS)-6-imino-2,3,8a-trimethyl-8-phenyl-2,3,5,8-tetrahydro-1H-isoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)C2=C[C@H](C)[NH+](C)C[C@@]2(C)[C@H](c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H21N5/c1-14-9-17-16(10-22)19(25)21(11-23,12-24)18(15-7-5-4-6-8-15)20(17,2)13-26(14)3/h4-9,14,16,18,25H,13H2,1-3H3/p+1/b25-19+/t14-,16+,18-,20+/m0/s1 |
| InChIKey | MKBQZZSJSANGOX-WVYPNIHKSA-O |
| XLogP | 1.83 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|