C19H14ClN5O2 — CID 4631542
2-amino-4-(4-chloro-3-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 4631542) has the molecular formula C19H14ClN5O2 and a molecular weight of 379.81 g/mol. Its IUPAC name is 2-amino-4-(4-chloro-3-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | 2-amino-4-(4-chloro-3-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 4631542 |
| Molecular Formula | C19H14ClN5O2 |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-amino-4-(4-chloro-3-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2ccc(Cl)c([N+](=O)[O-])c2)C2CCCC=C12 |
| InChI | InChI=1S/C19H14ClN5O2/c20-15-6-5-11(7-16(15)25(26)27)17-13-4-2-1-3-12(13)14(8-21)18(24)19(17,9-22)10-23/h3,5-7,13,17H,1-2,4,24H2 |
| InChIKey | QTVWGPDDNRVFTD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|