C19H15N5O2 — CID 682294
(4S,4aS)-2-amino-4-(4-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 682294) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is (4S,4aS)-2-amino-4-(4-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4S,4aS)-2-amino-4-(4-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 682294 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (4S,4aS)-2-amino-4-(4-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@H](c2ccc([N+](=O)[O-])cc2)[C@@H]2CCCC=C12 |
| InChI | InChI=1S/C19H15N5O2/c20-9-16-14-3-1-2-4-15(14)17(19(10-21,11-22)18(16)23)12-5-7-13(8-6-12)24(25)26/h3,5-8,15,17H,1-2,4,23H2/t15-,17-/m1/s1 |
| InChIKey | QVBWMJUFKQWFSF-NVXWUHKLSA-N |
| XLogP | 3.19 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|