C22H22N4O3 — CID 102396633
(6R)-4-amino-2-cyclohexyl-6-(4-methoxyphenyl)-1,3-dioxo-6,6a-dihydrocyclopenta[c]pyrrole-3a,5-dicarbonitrile (PubChem CID 102396633) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is (6R)-4-amino-2-cyclohexyl-6-(4-methoxyphenyl)-1,3-dioxo-6,6a-dihydrocyclopenta[c]pyrrole-3a,5-dicarbonitrile.
| Compound Name | (6R)-4-amino-2-cyclohexyl-6-(4-methoxyphenyl)-1,3-dioxo-6,6a-dihydrocyclopenta[c]pyrrole-3a,5-dicarbonitrile |
|---|---|
| PubChem CID | 102396633 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (6R)-4-amino-2-cyclohexyl-6-(4-methoxyphenyl)-1,3-dioxo-6,6a-dihydrocyclopenta[c]pyrrole-3a,5-dicarbonitrile |
| SMILES | COc1ccc([C@@H]2C(C#N)=C(N)C3(C#N)C(=O)N(C4CCCCC4)C(=O)C23)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-29-15-9-7-13(8-10-15)17-16(11-23)19(25)22(12-24)18(17)20(27)26(21(22)28)14-5-3-2-4-6-14/h7-10,14,17-18H,2-6,25H2,1H3/t17-,18?,22?/m1/s1 |
| InChIKey | SZEMLKKGEUMPER-PDDLGQBUSA-N |
| XLogP | 2.36 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|