C24H34N2O3 — CID 3401054
1-cycloheptyl-4-cyclohexyl-3-(4-methoxyphenyl)piperazine-2,5-dione (PubChem CID 3401054) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-cycloheptyl-4-cyclohexyl-3-(4-methoxyphenyl)piperazine-2,5-dione.
| Compound Name | 1-cycloheptyl-4-cyclohexyl-3-(4-methoxyphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 3401054 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 1-cycloheptyl-4-cyclohexyl-3-(4-methoxyphenyl)piperazine-2,5-dione |
| SMILES | COc1ccc(C2C(=O)N(C3CCCCCC3)CC(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H34N2O3/c1-29-21-15-13-18(14-16-21)23-24(28)25(19-9-5-2-3-6-10-19)17-22(27)26(23)20-11-7-4-8-12-20/h13-16,19-20,23H,2-12,17H2,1H3 |
| InChIKey | YIVDKBOAHJTESK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |