C20H21N5O — CID 98441746
(4aS,8S,8aR)-6-amino-8-(4-methoxyphenyl)-2-methyl-1,3,4,4a,8,8a-hexahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 98441746) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is (4aS,8S,8aR)-6-amino-8-(4-methoxyphenyl)-2-methyl-1,3,4,4a,8,8a-hexahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (4aS,8S,8aR)-6-amino-8-(4-methoxyphenyl)-2-methyl-1,3,4,4a,8,8a-hexahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 98441746 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (4aS,8S,8aR)-6-amino-8-(4-methoxyphenyl)-2-methyl-1,3,4,4a,8,8a-hexahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(C)CC[C@@H]3C(C#N)=C(N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C20H21N5O/c1-25-8-7-15-16(9-21)19(24)20(11-22,12-23)18(17(15)10-25)13-3-5-14(26-2)6-4-13/h3-6,15,17-18H,7-8,10,24H2,1-2H3/t15-,17-,18-/m1/s1 |
| InChIKey | URHXXNDPZXGTAG-KBAYOESNSA-N |
| XLogP | 2.13 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|